C33H65N3 — CID 58038487
4-[3,3-dimethyl-1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 58038487) has the molecular formula C33H65N3 and a molecular weight of 503.90 g/mol. Its IUPAC name is 4-[3,3-dimethyl-1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[3,3-dimethyl-1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 58038487 |
| Molecular Formula | C33H65N3 |
| Molecular Weight | 503.90 g/mol |
| Exact Mass | 503.52 |
| IUPAC Name | 4-[3,3-dimethyl-1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)butyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC(C)(C)CC(C1CC(C)(C)NC(C)(C)C1)(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C33H65N3/c1-26(2,3)22-33(23-16-27(4,5)34-28(6,7)17-23,24-18-29(8,9)35-30(10,11)19-24)25-20-31(12,13)36-32(14,15)21-25/h23-25,34-36H,16-22H2,1-15H3 |
| InChIKey | GLNYLPYUDARGGJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.90 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |