C73H96N5O15S+ — CID 58038780
CID 58038780 (PubChem CID 58038780) has the molecular formula C73H96N5O15S+ and a molecular weight of 1315.66 g/mol.
| Compound Name | CID 58038780 |
|---|---|
| PubChem CID | 58038780 |
| Molecular Formula | C73H96N5O15S+ |
| Molecular Weight | 1315.66 g/mol |
| Exact Mass | 1314.66 |
| IUPAC Name | — |
| SMILES | [CH]CCC[N+]1=C(/C=C/C2=C(Oc3ccccc3)/C(=C/C=C3/N(CCCCCC(=O)CCCCCC(CC(=O)CCCCC(=O)NCCCCC(NC(=O)NC(CCC(C)=O)C(=O)O)C(=O)O)C(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)CCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C73H95N5O15S/c1-7-8-46-77-62-35-19-18-33-58(62)72(3,4)64(77)43-38-51-26-24-27-52(67(51)93-56-31-15-10-16-32-56)39-44-65-73(5,6)59-49-57(94(90,91)92)40-42-63(59)78(65)47-23-11-14-29-54(80)28-13-9-12-25-53(68(83)84)48-55(81)30-17-20-36-66(82)74-45-22-21-34-60(69(85)86)75-71(89)76-61(70(87)88)41-37-50(2)79/h1,10,15-16,18-19,31-33,35,38-40,42-44,49,53,60-61H,7-9,11-14,17,20-30,34,36-37,41,45-48H2,2-6H3,(H6-,74,75,76,82,83,84,85,86,87,88,89,90,91,92)/p+1 |
| InChIKey | JXNYOSAKSVFYIV-UHFFFAOYSA-O |
| XLogP | 12.64 |
| TPSA | 303.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 94 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1315.66 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|