About CID 58038905
CID 58038905 (PubChem CID 58038905) has the molecular formula C32H33B2F2N4O6+2
and a molecular weight of 629.26 g/mol.
Molecular Properties
| Compound Name | CID 58038905 |
| PubChem CID | 58038905 |
| Molecular Formula | C32H33B2F2N4O6+2 |
| Molecular Weight | 629.26 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)NCCCNC(=O)c1cc(-c2ccc[n+](Cc3cc(F)ccc3B(O)O)c2)c[n+](Cc2cc(F)ccc2O[B]O)c1 |
| InChI | InChI=1S/C32H31B2F2N4O6/c1-21(2)31(41)37-10-4-11-38-32(42)26-13-23(17-40(20-26)19-25-15-28(36)7-9-30(25)46-33-43)22-5-3-12-39(16-22)18-24-14-27(35)6-8-29(24)34(44)45/h3,5-9,12-17,20,43-45H,1,4,10-11,18-19H2,2H3/p+2 |
| InChIKey | KBLQPZVTGNNDNB-UHFFFAOYSA-P |
| XLogP | 0.70 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 629.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 58038905 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58038905?
The IUPAC name of CID 58038905 (CID 58038905) is not available.
What is the SMILES notation for CID 58038905?
The canonical SMILES for CID 58038905 is C=C(C)C(=O)NCCCNC(=O)c1cc(-c2ccc[n+](Cc3cc(F)ccc3B(O)O)c2)c[n+](Cc2cc(F)ccc2O[B]O)c1.
What is the InChIKey of CID 58038905?
The InChIKey is KBLQPZVTGNNDNB-UHFFFAOYSA-P. The full InChI is InChI=1S/C32H31B2F2N4O6/c1-21(2)31(41)37-10-4-11-38-32(42)26-13-23(17-40(20-26)19-25-15-28(36)7-9-30(25)46-33-43)22-5-3-12-39(16-22)18-24-14-27(35)6-8-29(24)34(44)45/h3,5-9,12-17,20,43-45H,1,4,10-11,18-19H2,2H3/p+2.
What are the key properties of CID 58038905?
CID 58038905 has a molecular weight of 629.26 g/mol, XLogP of 0.70, 14 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58038905 is sourced from PubChem (CID 58038905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).