About 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile
1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile (PubChem CID 58039103) has the molecular formula C23H23N3O3
and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile |
| PubChem CID | 58039103 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile |
| SMILES | CCn1c(-c2cccc(N3CCOC3=O)c2)c(C#N)c2ccc(OC(C)C)cc21 |
| InChI | InChI=1S/C23H23N3O3/c1-4-25-21-13-18(29-15(2)3)8-9-19(21)20(14-24)22(25)16-6-5-7-17(12-16)26-10-11-28-23(26)27/h5-9,12-13,15H,4,10-11H2,1-3H3 |
| InChIKey | ROASELDKJKUZAG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile?
The IUPAC name of 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile (CID 58039103) is 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile.
What is the SMILES notation for 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile?
The canonical SMILES for 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile is CCn1c(-c2cccc(N3CCOC3=O)c2)c(C#N)c2ccc(OC(C)C)cc21.
What is the InChIKey of 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile?
The InChIKey is ROASELDKJKUZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O3/c1-4-25-21-13-18(29-15(2)3)8-9-19(21)20(14-24)22(25)16-6-5-7-17(12-16)26-10-11-28-23(26)27/h5-9,12-13,15H,4,10-11H2,1-3H3.
What are the key properties of 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile?
1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile has a molecular weight of 389.46 g/mol, XLogP of 4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-6-propan-2-yloxyindole-3-carbonitrile is sourced from PubChem (CID 58039103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).