C13H17FN5O12P3 — CID 58039185
[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 58039185) has the molecular formula C13H17FN5O12P3 and a molecular weight of 547.22 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 58039185 |
| Molecular Formula | C13H17FN5O12P3 |
| Molecular Weight | 547.22 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@]1(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C13H17FN5O12P3/c1-12(14)10(20)8(4-28-33(24,25)31-34(26,27)30-32(21,22)23)29-13(12,5-15)9-3-2-7-11(16)17-6-18-19(7)9/h2-3,6,8,10,20H,4H2,1H3,(H,24,25)(H,26,27)(H2,16,17,18)(H2,21,22,23)/t8-,10-,12-,13+/m1/s1 |
| InChIKey | WZMSOZDWQGLRBL-DXLKZPDWSA-N |
| XLogP | -0.14 |
| TPSA | 269.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|