C20H17F6N5O2 — CID 58039357
4-N-[(3-methoxyphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 58039357) has the molecular formula C20H17F6N5O2 and a molecular weight of 473.38 g/mol. Its IUPAC name is 4-N-[(3-methoxyphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(3-methoxyphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039357 |
| Molecular Formula | C20H17F6N5O2 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 4-N-[(3-methoxyphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cccc(CNc2nc(Nc3cccc(C(F)(F)F)c3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H17F6N5O2/c1-32-15-7-2-4-12(8-15)10-27-16-29-17(31-18(30-16)33-11-19(21,22)23)28-14-6-3-5-13(9-14)20(24,25)26/h2-9H,10-11H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | MRTUSBWFAYSSKU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |