C20H14F9N5O2 — CID 58039471
6-(2,2,2-trifluoroethoxy)-2-N-[3-(2,2,2-trifluoroethoxy)phenyl]-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 58039471) has the molecular formula C20H14F9N5O2 and a molecular weight of 527.35 g/mol. Its IUPAC name is 6-(2,2,2-trifluoroethoxy)-2-N-[3-(2,2,2-trifluoroethoxy)phenyl]-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,2,2-trifluoroethoxy)-2-N-[3-(2,2,2-trifluoroethoxy)phenyl]-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039471 |
| Molecular Formula | C20H14F9N5O2 |
| Molecular Weight | 527.35 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 6-(2,2,2-trifluoroethoxy)-2-N-[3-(2,2,2-trifluoroethoxy)phenyl]-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)COc1cccc(Nc2nc(Nc3cccc(C(F)(F)F)c3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H14F9N5O2/c21-18(22,23)9-35-14-6-2-5-13(8-14)31-16-32-15(33-17(34-16)36-10-19(24,25)26)30-12-4-1-3-11(7-12)20(27,28)29/h1-8H,9-10H2,(H2,30,31,32,33,34) |
| InChIKey | NQLUHZBGKPYVNB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.35 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |