C26H21F6N5O2 — CID 58039991
4-N-[[4-(4-methoxyphenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 58039991) has the molecular formula C26H21F6N5O2 and a molecular weight of 549.48 g/mol. Its IUPAC name is 4-N-[[4-(4-methoxyphenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[[4-(4-methoxyphenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039991 |
| Molecular Formula | C26H21F6N5O2 |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 4-N-[[4-(4-methoxyphenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(-c2ccc(CNc3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)cc2)cc1 |
| InChI | InChI=1S/C26H21F6N5O2/c1-38-21-11-9-18(10-12-21)17-7-5-16(6-8-17)14-33-22-35-23(37-24(36-22)39-15-25(27,28)29)34-20-4-2-3-19(13-20)26(30,31)32/h2-13H,14-15H2,1H3,(H2,33,34,35,36,37) |
| InChIKey | ODWSISDQYHWUJS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |