C15H18F3N5O4S — CID 58040093
4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 58040093) has the molecular formula C15H18F3N5O4S and a molecular weight of 421.40 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58040093 |
| Molecular Formula | C15H18F3N5O4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(5-methylfuran-2-yl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(CNc2nc(OCC(F)(F)F)nc(N3CCS(=O)(=O)CC3)n2)o1 |
| InChI | InChI=1S/C15H18F3N5O4S/c1-10-2-3-11(27-10)8-19-12-20-13(23-4-6-28(24,25)7-5-23)22-14(21-12)26-9-15(16,17)18/h2-3H,4-9H2,1H3,(H,19,20,21,22) |
| InChIKey | ZCBSDDHBAVUZSW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |