C16H18F6O5 — CID 58040810
1,1,1,3,3,3-hexafluoropropan-2-yl 2-butan-2-yloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 58040810) has the molecular formula C16H18F6O5 and a molecular weight of 404.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-butan-2-yloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-butan-2-yloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 58040810 |
| Molecular Formula | C16H18F6O5 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-butan-2-yloxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC(C)OC1C2CC3C1OC(=O)C3C2C(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H18F6O5/c1-3-5(2)25-10-6-4-7-8(12(23)26-11(7)10)9(6)13(24)27-14(15(17,18)19)16(20,21)22/h5-11,14H,3-4H2,1-2H3 |
| InChIKey | JQCYLXUEWUMWMM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |