C20H24F6O7 — CID 58040834
[10-oxo-3',5'-bis(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl] 2,2-dimethylbutanoate (PubChem CID 58040834) has the molecular formula C20H24F6O7 and a molecular weight of 490.39 g/mol. Its IUPAC name is [10-oxo-3',5'-bis(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl] 2,2-dimethylbutanoate.
| Compound Name | [10-oxo-3',5'-bis(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58040834 |
| Molecular Formula | C20H24F6O7 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [10-oxo-3',5'-bis(trifluoromethyl)spiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1C(=O)OC2C3OC4(CC(C(F)(F)F)CC(C(F)(F)F)C4)OC3OC12 |
| InChI | InChI=1S/C20H24F6O7/c1-4-17(2,3)16(28)31-12-10-11(29-14(12)27)13-15(30-10)33-18(32-13)6-8(19(21,22)23)5-9(7-18)20(24,25)26/h8-13,15H,4-7H2,1-3H3 |
| InChIKey | PMNMLFPDHVCNMN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |