C15H18O9 — CID 58040837
[2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 58040837) has the molecular formula C15H18O9 and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58040837 |
| Molecular Formula | C15H18O9 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C(=O)OC2C3OC(C)(C)OC3OC12 |
| InChI | InChI=1S/C15H18O9/c1-6(2)12(17)19-5-7(16)20-10-8-9(21-13(10)18)11-14(22-8)24-15(3,4)23-11/h8-11,14H,1,5H2,2-4H3 |
| InChIKey | YBZAFOIPXLZPPM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|