C21H38N2O2 — CID 58041336
1-[3-(dimethylamino)propyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione (PubChem CID 58041336) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58041336 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrolidine-2,5-dione |
| SMILES | C=C(CC1CC(=O)N(CCCN(C)C)C1=O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H38N2O2/c1-16(14-21(5,6)15-20(2,3)4)12-17-13-18(24)23(19(17)25)11-9-10-22(7)8/h17H,1,9-15H2,2-8H3 |
| InChIKey | QRDAKKVVEQHVCZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|