C31H30N6O7 — CID 58041882
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-[[2-(2-morpholin-4-ylethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 58041882) has the molecular formula C31H30N6O7 and a molecular weight of 598.62 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-[[2-(2-morpholin-4-ylethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-[[2-(2-morpholin-4-ylethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58041882 |
| Molecular Formula | C31H30N6O7 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-[[2-(2-morpholin-4-ylethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(Nc4c(NCCN5CCOCC5)c(=O)c4=O)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C31H30N6O7/c1-43-22-7-4-20-17-37(28(40)23(20)16-22)18-31(29(41)34-30(42)35-31)9-8-19-2-5-21(6-3-19)33-25-24(26(38)27(25)39)32-10-11-36-12-14-44-15-13-36/h2-7,16,32-33H,10-15,17-18H2,1H3,(H2,34,35,41,42)/t31-/m1/s1 |
| InChIKey | WNZOADFTOPLTQV-WJOKGBTCSA-N |
| XLogP | 0.36 |
| TPSA | 158.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|