C32H24N4O5 — CID 58041982
(3S)-3-[2-[4-(3-hydroxy-6-pyridin-3-yl-2-pyridinyl)phenyl]ethynyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 58041982) has the molecular formula C32H24N4O5 and a molecular weight of 544.57 g/mol. Its IUPAC name is (3S)-3-[2-[4-(3-hydroxy-6-pyridin-3-yl-2-pyridinyl)phenyl]ethynyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[2-[4-(3-hydroxy-6-pyridin-3-yl-2-pyridinyl)phenyl]ethynyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58041982 |
| Molecular Formula | C32H24N4O5 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (3S)-3-[2-[4-(3-hydroxy-6-pyridin-3-yl-2-pyridinyl)phenyl]ethynyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(-c4nc(-c5cccnc5)ccc4O)cc3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C32H24N4O5/c1-41-24-9-8-23-18-36(30(39)25(23)15-24)19-32(16-28(38)35-31(32)40)13-12-20-4-6-21(7-5-20)29-27(37)11-10-26(34-29)22-3-2-14-33-17-22/h2-11,14-15,17,37H,16,18-19H2,1H3,(H,35,38,40)/t32-/m1/s1 |
| InChIKey | HUPAODHVIVHWGL-JGCGQSQUSA-N |
| XLogP | 3.57 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|