C25H23N5O5 — CID 58042057
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(4-oxopiperidin-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 58042057) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(4-oxopiperidin-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(4-oxopiperidin-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58042057 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(4-oxopiperidin-1-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(N4CCC(=O)CC4)nc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H23N5O5/c1-35-19-4-3-17-14-30(22(32)20(17)12-19)15-25(23(33)27-24(34)28-25)9-6-16-2-5-21(26-13-16)29-10-7-18(31)8-11-29/h2-5,12-13H,7-8,10-11,14-15H2,1H3,(H2,27,28,33,34)/t25-/m1/s1 |
| InChIKey | OHIKFHUFYCONMB-RUZDIDTESA-N |
| XLogP | 0.85 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|