C27H27FN4O4 — CID 58042095
(3S)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[2-[6-(piperidin-1-ylmethyl)-3-pyridinyl]ethynyl]pyrrolidine-2,5-dione (PubChem CID 58042095) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is (3S)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[2-[6-(piperidin-1-ylmethyl)-3-pyridinyl]ethynyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[2-[6-(piperidin-1-ylmethyl)-3-pyridinyl]ethynyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58042095 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (3S)-3-[(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-3-[2-[6-(piperidin-1-ylmethyl)-3-pyridinyl]ethynyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N(C[C@@]1(C#Cc3ccc(CN4CCCCC4)nc3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H27FN4O4/c1-36-21-8-6-19-15-32(25(34)23(19)24(21)28)17-27(13-22(33)30-26(27)35)10-9-18-5-7-20(29-14-18)16-31-11-3-2-4-12-31/h5-8,14H,2-4,11-13,15-17H2,1H3,(H,30,33,35)/t27-/m1/s1 |
| InChIKey | RCLVVZUNQCXMQL-HHHXNRCGSA-N |
| XLogP | 2.26 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|