C23H18N6O4S — CID 58042200
(5R)-5-[2-[5-(2-amino-1,3-thiazol-4-yl)-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 58042200) has the molecular formula C23H18N6O4S and a molecular weight of 474.50 g/mol. Its IUPAC name is (5R)-5-[2-[5-(2-amino-1,3-thiazol-4-yl)-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[5-(2-amino-1,3-thiazol-4-yl)-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58042200 |
| Molecular Formula | C23H18N6O4S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (5R)-5-[2-[5-(2-amino-1,3-thiazol-4-yl)-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3cncc(-c4csc(N)n4)c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H18N6O4S/c1-33-16-3-2-14-10-29(19(30)17(14)7-16)12-23(20(31)27-22(32)28-23)5-4-13-6-15(9-25-8-13)18-11-34-21(24)26-18/h2-3,6-9,11H,10,12H2,1H3,(H2,24,26)(H2,27,28,31,32)/t23-/m1/s1 |
| InChIKey | HSKNVWDOYYTFOJ-HSZRJFAPSA-N |
| XLogP | 1.38 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|