C23H20ClF2NO4 — CID 58042432
(4-methylphenyl) 4-[[5-chloro-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]oxy-3-pyridinyl]oxy]-2,5-difluorobenzoate (PubChem CID 58042432) has the molecular formula C23H20ClF2NO4 and a molecular weight of 456.92 g/mol. Its IUPAC name is (4-methylphenyl) 4-[[5-chloro-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]oxy-3-pyridinyl]oxy]-2,5-difluorobenzoate.
| Compound Name | (4-methylphenyl) 4-[[5-chloro-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]oxy-3-pyridinyl]oxy]-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 58042432 |
| Molecular Formula | C23H20ClF2NO4 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (4-methylphenyl) 4-[[5-chloro-6-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]oxy-3-pyridinyl]oxy]-2,5-difluorobenzoate |
| SMILES | [2H]C([2H])([2H])C(Oc1ncc(Oc2cc(F)c(C(=O)Oc3ccc(C)cc3)cc2F)cc1Cl)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C23H20ClF2NO4/c1-13-5-7-14(8-6-13)30-22(28)16-10-19(26)20(11-18(16)25)29-15-9-17(24)21(27-12-15)31-23(2,3)4/h5-12H,1-4H3/i2D3,3D3,4D3 |
| InChIKey | GCBCHTIFZSZKIO-WVZRYRIDSA-N |
| XLogP | 6.51 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|