About tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate
tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate (PubChem CID 58042478) has the molecular formula C17H16ClF2NO3
and a molecular weight of 355.77 g/mol. Its IUPAC name is tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate |
| PubChem CID | 58042478 |
| Molecular Formula | C17H16ClF2NO3 |
| Molecular Weight | 355.77 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate |
| SMILES | Cc1ncc(Oc2cc(F)c(C(=O)OC(C)(C)C)cc2F)cc1Cl |
| InChI | InChI=1S/C17H16ClF2NO3/c1-9-12(18)5-10(8-21-9)23-15-7-13(19)11(6-14(15)20)16(22)24-17(2,3)4/h5-8H,1-4H3 |
| InChIKey | LRROSVBNCVOKGM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate?
The IUPAC name of tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate (CID 58042478) is tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate.
What is the SMILES notation for tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate?
The canonical SMILES for tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate is Cc1ncc(Oc2cc(F)c(C(=O)OC(C)(C)C)cc2F)cc1Cl.
What is the InChIKey of tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate?
The InChIKey is LRROSVBNCVOKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClF2NO3/c1-9-12(18)5-10(8-21-9)23-15-7-13(19)11(6-14(15)20)16(22)24-17(2,3)4/h5-8H,1-4H3.
What are the key properties of tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate?
tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate has a molecular weight of 355.77 g/mol, XLogP of 5.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(5-chloro-6-methyl-3-pyridinyl)oxy]-2,5-difluorobenzoate is sourced from PubChem (CID 58042478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).