C16H18N4O2 — CID 58042964
3-(2-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,2-oxazole-5-carboxamide (PubChem CID 58042964) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-(2-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(2-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 58042964 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-(2-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1cc(N2CC3CN(c4ccccc4)CC3C2)no1 |
| InChI | InChI=1S/C16H18N4O2/c17-16(21)14-6-15(18-22-14)20-9-11-7-19(8-12(11)10-20)13-4-2-1-3-5-13/h1-6,11-12H,7-10H2,(H2,17,21) |
| InChIKey | WBPWPQTWYMUPMU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |