C25H21ClF4N2O3 — CID 58043583
5-[(E)-C-[2-(2-chlorophenyl)-2-[3-fluoro-4-(4,4,4-trifluorobutanoyl)phenyl]ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one (PubChem CID 58043583) has the molecular formula C25H21ClF4N2O3 and a molecular weight of 508.90 g/mol. Its IUPAC name is 5-[(E)-C-[2-(2-chlorophenyl)-2-[3-fluoro-4-(4,4,4-trifluorobutanoyl)phenyl]ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one.
| Compound Name | 5-[(E)-C-[2-(2-chlorophenyl)-2-[3-fluoro-4-(4,4,4-trifluorobutanoyl)phenyl]ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 58043583 |
| Molecular Formula | C25H21ClF4N2O3 |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 5-[(E)-C-[2-(2-chlorophenyl)-2-[3-fluoro-4-(4,4,4-trifluorobutanoyl)phenyl]ethyl]-N-hydroxycarbonimidoyl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(/C(CC(c2ccc(C(=O)CCC(F)(F)F)c(F)c2)c2ccccc2Cl)=N/O)ccc1=O |
| InChI | InChI=1S/C25H21ClF4N2O3/c1-32-14-16(7-9-24(32)34)22(31-35)13-19(17-4-2-3-5-20(17)26)15-6-8-18(21(27)12-15)23(33)10-11-25(28,29)30/h2-9,12,14,19,35H,10-11,13H2,1H3/b31-22+ |
| InChIKey | VFNMFAOIPMONDY-DFKUXCBWSA-N |
| XLogP | 6.10 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|