C28H26N4O3S — CID 58043873
2-[2-(hydroxymethyl)-3-[6-oxo-5-(pyrimidin-4-ylmethyl)-1H-pyridin-3-yl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one (PubChem CID 58043873) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-3-[6-oxo-5-(pyrimidin-4-ylmethyl)-1H-pyridin-3-yl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one.
| Compound Name | 2-[2-(hydroxymethyl)-3-[6-oxo-5-(pyrimidin-4-ylmethyl)-1H-pyridin-3-yl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 58043873 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[2-(hydroxymethyl)-3-[6-oxo-5-(pyrimidin-4-ylmethyl)-1H-pyridin-3-yl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
| SMILES | O=C1c2sc3c(c2CCN1c1cccc(-c2c[nH]c(=O)c(Cc4ccncn4)c2)c1CO)CCCC3 |
| InChI | InChI=1S/C28H26N4O3S/c33-15-23-20(18-12-17(27(34)30-14-18)13-19-8-10-29-16-31-19)5-3-6-24(23)32-11-9-22-21-4-1-2-7-25(21)36-26(22)28(32)35/h3,5-6,8,10,12,14,16,33H,1-2,4,7,9,11,13,15H2,(H,30,34) |
| InChIKey | UGTZEQBYCJWSPF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |