About 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one
5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one (PubChem CID 58043918) has the molecular formula C14H18BrN5O
and a molecular weight of 352.24 g/mol. Its IUPAC name is 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one |
| PubChem CID | 58043918 |
| Molecular Formula | C14H18BrN5O |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one |
| SMILES | CCN1CCn2nc(Nc3cc(Br)cn(C)c3=O)cc2C1 |
| InChI | InChI=1S/C14H18BrN5O/c1-3-19-4-5-20-11(9-19)7-13(17-20)16-12-6-10(15)8-18(2)14(12)21/h6-8H,3-5,9H2,1-2H3,(H,16,17) |
| InChIKey | WTFVNACKLSFYMX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one?
The IUPAC name of 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one (CID 58043918) is 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one.
What is the SMILES notation for 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one?
The canonical SMILES for 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one is CCN1CCn2nc(Nc3cc(Br)cn(C)c3=O)cc2C1.
What is the InChIKey of 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one?
The InChIKey is WTFVNACKLSFYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN5O/c1-3-19-4-5-20-11(9-19)7-13(17-20)16-12-6-10(15)8-18(2)14(12)21/h6-8H,3-5,9H2,1-2H3,(H,16,17).
What are the key properties of 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one?
5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one has a molecular weight of 352.24 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[(5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl)amino]-1-methylpyridin-2-one is sourced from PubChem (CID 58043918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).