C18H25BN4O4 — CID 58044028
3-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylamino)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 58044028) has the molecular formula C18H25BN4O4 and a molecular weight of 372.23 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylamino)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylamino)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58044028 |
| Molecular Formula | C18H25BN4O4 |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-(6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-ylamino)-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)cc(Nc2cc3n(n2)CCOC3)c1=O |
| InChI | InChI=1S/C18H25BN4O4/c1-17(2)18(3,4)27-19(26-17)12-8-14(16(24)22(5)10-12)20-15-9-13-11-25-7-6-23(13)21-15/h8-10H,6-7,11H2,1-5H3,(H,20,21) |
| InChIKey | YCBWRXZPJHLJGK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|