C36H42N6O2S — CID 58044172
2-[2-ethyl-3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one (PubChem CID 58044172) has the molecular formula C36H42N6O2S and a molecular weight of 622.84 g/mol. Its IUPAC name is 2-[2-ethyl-3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one.
| Compound Name | 2-[2-ethyl-3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 58044172 |
| Molecular Formula | C36H42N6O2S |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 2-[2-ethyl-3-[5-[[5-(4-ethylpiperazin-1-yl)-2-pyridinyl]amino]-1-methyl-6-oxo-3-pyridinyl]phenyl]-3,4,5,6,7,8-hexahydro-[1]benzothiolo[2,3-c]pyridin-1-one |
| SMILES | CCc1c(-c2cc(Nc3ccc(N4CCN(CC)CC4)cn3)c(=O)n(C)c2)cccc1N1CCc2c(sc3c2CCCC3)C1=O |
| InChI | InChI=1S/C36H42N6O2S/c1-4-26-27(10-8-11-31(26)42-16-15-29-28-9-6-7-12-32(28)45-34(29)36(42)44)24-21-30(35(43)39(3)23-24)38-33-14-13-25(22-37-33)41-19-17-40(5-2)18-20-41/h8,10-11,13-14,21-23H,4-7,9,12,15-20H2,1-3H3,(H,37,38) |
| InChIKey | AQEIKNBMWXZZSP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 73.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |