C17H25BN4O3 — CID 58044196
3-[(1,5-dimethylpyrazol-3-yl)amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (PubChem CID 58044196) has the molecular formula C17H25BN4O3 and a molecular weight of 344.22 g/mol. Its IUPAC name is 3-[(1,5-dimethylpyrazol-3-yl)amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one.
| Compound Name | 3-[(1,5-dimethylpyrazol-3-yl)amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58044196 |
| Molecular Formula | C17H25BN4O3 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[(1,5-dimethylpyrazol-3-yl)amino]-1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| SMILES | Cc1cc(Nc2cc(B3OC(C)(C)C(C)(C)O3)cn(C)c2=O)nn1C |
| InChI | InChI=1S/C17H25BN4O3/c1-11-8-14(20-22(11)7)19-13-9-12(10-21(6)15(13)23)18-24-16(2,3)17(4,5)25-18/h8-10H,1-7H3,(H,19,20) |
| InChIKey | XOTZUPSSMGMVLB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|