About 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine
5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 58044222) has the molecular formula C9H12N4O2
and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| PubChem CID | 58044222 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | O=[N+]([O-])c1cc2n(n1)CCN(C1CC1)C2 |
| InChI | InChI=1S/C9H12N4O2/c14-13(15)9-5-8-6-11(7-1-2-7)3-4-12(8)10-9/h5,7H,1-4,6H2 |
| InChIKey | JOCFYNKWCKGZAF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The IUPAC name of 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (CID 58044222) is 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The canonical SMILES for 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is O=[N+]([O-])c1cc2n(n1)CCN(C1CC1)C2.
What is the InChIKey of 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The InChIKey is JOCFYNKWCKGZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O2/c14-13(15)9-5-8-6-11(7-1-2-7)3-4-12(8)10-9/h5,7H,1-4,6H2.
What are the key properties of 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine has a molecular weight of 208.22 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2-nitro-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 58044222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).