About 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole
1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole (PubChem CID 58044377) has the molecular formula C14H16ClF2N3O
and a molecular weight of 315.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole |
| PubChem CID | 58044377 |
| Molecular Formula | C14H16ClF2N3O |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole |
| SMILES | CC(C)(C)C(F)(F)OCc1cn(-c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C14H16ClF2N3O/c1-13(2,3)14(16,17)21-9-11-8-20(19-18-11)12-6-4-10(15)5-7-12/h4-8H,9H2,1-3H3 |
| InChIKey | ASLVWDXDGRNZQY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole?
The IUPAC name of 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole (CID 58044377) is 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole.
What is the SMILES notation for 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole?
The canonical SMILES for 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole is CC(C)(C)C(F)(F)OCc1cn(-c2ccc(Cl)cc2)nn1.
What is the InChIKey of 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole?
The InChIKey is ASLVWDXDGRNZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClF2N3O/c1-13(2,3)14(16,17)21-9-11-8-20(19-18-11)12-6-4-10(15)5-7-12/h4-8H,9H2,1-3H3.
What are the key properties of 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole?
1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole has a molecular weight of 315.75 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-4-[(1,1-difluoro-2,2-dimethylpropoxy)methyl]triazole is sourced from PubChem (CID 58044377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).