About 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol
1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol (PubChem CID 58044416) has the molecular formula C9H16F2O
and a molecular weight of 178.22 g/mol. Its IUPAC name is 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol |
| PubChem CID | 58044416 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(C)C(F)(F)C(O)C1CC1 |
| InChI | InChI=1S/C9H16F2O/c1-8(2,3)9(10,11)7(12)6-4-5-6/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | IHRYHWCTYOXARX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol?
The IUPAC name of 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol (CID 58044416) is 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol.
What is the SMILES notation for 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol?
The canonical SMILES for 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol is CC(C)(C)C(F)(F)C(O)C1CC1.
What is the InChIKey of 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol?
The InChIKey is IHRYHWCTYOXARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2O/c1-8(2,3)9(10,11)7(12)6-4-5-6/h6-7,12H,4-5H2,1-3H3.
What are the key properties of 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol?
1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol has a molecular weight of 178.22 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2,2-difluoro-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 58044416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).