C25H15F3N6O5 — CID 58044498
2-[[3-[[3-oxo-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-2-yl]methyl]-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione (PubChem CID 58044498) has the molecular formula C25H15F3N6O5 and a molecular weight of 536.43 g/mol. Its IUPAC name is 2-[[3-[[3-oxo-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-2-yl]methyl]-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[[3-oxo-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-2-yl]methyl]-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58044498 |
| Molecular Formula | C25H15F3N6O5 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 2-[[3-[[3-oxo-6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-2-yl]methyl]-1,2,4-oxadiazol-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc(Cn2nc3ccc(-c4ccc(OC(F)(F)F)cc4)cn3c2=O)no1 |
| InChI | InChI=1S/C25H15F3N6O5/c26-25(27,28)38-16-8-5-14(6-9-16)15-7-10-20-30-34(24(37)32(20)11-15)12-19-29-21(39-31-19)13-33-22(35)17-3-1-2-4-18(17)23(33)36/h1-11H,12-13H2 |
| InChIKey | GECBYKRXMYAANX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 124.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|