C28H27N3O5 — CID 58044900
4-[(Z)-[2-cyclohexyl-1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N-methylbenzamide (PubChem CID 58044900) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[(Z)-[2-cyclohexyl-1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N-methylbenzamide.
| Compound Name | 4-[(Z)-[2-cyclohexyl-1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58044900 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[(Z)-[2-cyclohexyl-1-[4-(1,2-oxazol-3-yl)phenyl]-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(-c4ccon4)cc3)C2C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H27N3O5/c1-29-27(34)20-9-7-19(8-10-20)25(32)23-24(18-5-3-2-4-6-18)31(28(35)26(23)33)21-13-11-17(12-14-21)22-15-16-36-30-22/h7-16,18,24,32H,2-6H2,1H3,(H,29,34)/b25-23- |
| InChIKey | XNBZCFVJZXYRGH-BZZOAKBMSA-N |
| XLogP | 4.54 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|