About methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate
methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate (PubChem CID 58045013) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate |
| PubChem CID | 58045013 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate |
| SMILES | COC(=O)/C(O)=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H14O4/c1-9(2,3)7(11)5-6(10)8(12)13-4/h5,10H,1-4H3/b6-5- |
| InChIKey | PIXOROCTBXQLML-WAYWQWQTSA-N |
| XLogP | 1.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate?
The IUPAC name of methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate (CID 58045013) is methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate.
What is the SMILES notation for methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate?
The canonical SMILES for methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate is COC(=O)/C(O)=C/C(=O)C(C)(C)C.
What is the InChIKey of methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate?
The InChIKey is PIXOROCTBXQLML-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H14O4/c1-9(2,3)7(11)5-6(10)8(12)13-4/h5,10H,1-4H3/b6-5-.
What are the key properties of methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate?
methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate has a molecular weight of 186.21 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-hydroxy-5,5-dimethyl-4-oxohex-2-enoate is sourced from PubChem (CID 58045013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).