C26H25N3O5 — CID 58045105
(4Z)-5-cyclohexyl-4-[hydroxy-(6-methoxy-3-pyridinyl)methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione (PubChem CID 58045105) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is (4Z)-5-cyclohexyl-4-[hydroxy-(6-methoxy-3-pyridinyl)methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-cyclohexyl-4-[hydroxy-(6-methoxy-3-pyridinyl)methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 58045105 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (4Z)-5-cyclohexyl-4-[hydroxy-(6-methoxy-3-pyridinyl)methylidene]-1-[4-(1,2-oxazol-3-yl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(-c4ccon4)cc3)C2C2CCCCC2)cn1 |
| InChI | InChI=1S/C26H25N3O5/c1-33-21-12-9-18(15-27-21)24(30)22-23(17-5-3-2-4-6-17)29(26(32)25(22)31)19-10-7-16(8-11-19)20-13-14-34-28-20/h7-15,17,23,30H,2-6H2,1H3/b24-22- |
| InChIKey | WISDNDJNOPJVAN-GYHWCHFESA-N |
| XLogP | 4.58 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|