C25H28FN5O3 — CID 58045452
N-[[(5S)-3-[3-fluoro-4-[4-[5-(2H-triazol-4-yl)pentyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 58045452) has the molecular formula C25H28FN5O3 and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[4-[5-(2H-triazol-4-yl)pentyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[4-[5-(2H-triazol-4-yl)pentyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58045452 |
| Molecular Formula | C25H28FN5O3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[4-[5-(2H-triazol-4-yl)pentyl]phenyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(-c3ccc(CCCCCc4cn[nH]n4)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H28FN5O3/c1-17(32)27-15-22-16-31(25(33)34-22)21-11-12-23(24(26)13-21)19-9-7-18(8-10-19)5-3-2-4-6-20-14-28-30-29-20/h7-14,22H,2-6,15-16H2,1H3,(H,27,32)(H,28,29,30)/t22-/m0/s1 |
| InChIKey | FODISNCQXIASHO-QFIPXVFZSA-N |
| XLogP | 4.03 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|