C40H34FN3O2 — CID 58045534
(5S)-5-ethyl-3-[3-fluoro-4-[4-[(1-tritylimidazol-4-yl)methyl]phenyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 58045534) has the molecular formula C40H34FN3O2 and a molecular weight of 607.73 g/mol. Its IUPAC name is (5S)-5-ethyl-3-[3-fluoro-4-[4-[(1-tritylimidazol-4-yl)methyl]phenyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-ethyl-3-[3-fluoro-4-[4-[(1-tritylimidazol-4-yl)methyl]phenyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58045534 |
| Molecular Formula | C40H34FN3O2 |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | (5S)-5-ethyl-3-[3-fluoro-4-[4-[(1-tritylimidazol-4-yl)methyl]phenyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@H]1CN(c2ccc(-c3ccc(Cc4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)cn4)cc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C40H34FN3O2/c1-2-36-27-44(39(45)46-36)35-22-23-37(38(41)25-35)30-20-18-29(19-21-30)24-34-26-43(28-42-34)40(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33/h3-23,25-26,28,36H,2,24,27H2,1H3/t36-/m0/s1 |
| InChIKey | OODIKDOJWMTANP-BHVANESWSA-N |
| XLogP | 8.86 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|