C23H30N6O4 — CID 58045842
2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,7,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide (PubChem CID 58045842) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,7,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide.
| Compound Name | 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,7,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 58045842 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[2-[3-tert-butyl-5-(2-hydroxyethoxy)phenyl]-2-oxoethyl]-3-imino-N,7,8-trimethyl-[1,2,4]triazolo[4,3-b]pyridazine-6-carboxamide |
| SMILES | [H]/N=c1\n(CC(=O)c2cc(OCCO)cc(C(C)(C)C)c2)nc2c(C)c(C)c(C(=O)NC)nn12 |
| InChI | InChI=1S/C23H30N6O4/c1-13-14(2)20-27-28(22(24)29(20)26-19(13)21(32)25-6)12-18(31)15-9-16(23(3,4)5)11-17(10-15)33-8-7-30/h9-11,24,30H,7-8,12H2,1-6H3,(H,25,32)/b24-22+ |
| InChIKey | FYWZYWOOKVUKPB-ZNTNEXAZSA-N |
| XLogP | 1.54 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |