C20H32O2 — CID 58046495
(4aR,8aR)-4a,8a-dimethyl-3-(oxolan-3-yl)-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one (PubChem CID 58046495) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4aR,8aR)-4a,8a-dimethyl-3-(oxolan-3-yl)-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one.
| Compound Name | (4aR,8aR)-4a,8a-dimethyl-3-(oxolan-3-yl)-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one |
|---|---|
| PubChem CID | 58046495 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4aR,8aR)-4a,8a-dimethyl-3-(oxolan-3-yl)-3,4,4b,5,6,7,8,9,10,10a-decahydro-2H-phenanthren-1-one |
| SMILES | C[C@]12CCCCC1[C@@]1(C)CC(C3CCOC3)CC(=O)C1CC2 |
| InChI | InChI=1S/C20H32O2/c1-19-8-4-3-5-18(19)20(2)12-15(14-7-10-22-13-14)11-17(21)16(20)6-9-19/h14-16,18H,3-13H2,1-2H3/t14?,15?,16?,18?,19-,20+/m1/s1 |
| InChIKey | ZIOGHXSWHSFYTC-NEQWZTAVSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |