About 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine]
1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] (PubChem CID 58046534) has the molecular formula C21H22ClFN2
and a molecular weight of 356.87 g/mol. Its IUPAC name is 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine].
Molecular Properties
| Compound Name | 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] |
| PubChem CID | 58046534 |
| Molecular Formula | C21H22ClFN2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] |
| SMILES | Fc1ccc2c(c1)C1(CCN(C/C=C/c3ccc(Cl)cc3)CC1)CN2 |
| InChI | InChI=1S/C21H22ClFN2/c22-17-5-3-16(4-6-17)2-1-11-25-12-9-21(10-13-25)15-24-20-8-7-18(23)14-19(20)21/h1-8,14,24H,9-13,15H2/b2-1+ |
| InChIKey | DISPPDHCSOHOAW-OWOJBTEDSA-N |
| XLogP | 4.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine]?
The IUPAC name of 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] (CID 58046534) is 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine].
What is the SMILES notation for 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine]?
The canonical SMILES for 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] is Fc1ccc2c(c1)C1(CCN(C/C=C/c3ccc(Cl)cc3)CC1)CN2.
What is the InChIKey of 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine]?
The InChIKey is DISPPDHCSOHOAW-OWOJBTEDSA-N. The full InChI is InChI=1S/C21H22ClFN2/c22-17-5-3-16(4-6-17)2-1-11-25-12-9-21(10-13-25)15-24-20-8-7-18(23)14-19(20)21/h1-8,14,24H,9-13,15H2/b2-1+.
What are the key properties of 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine]?
1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] has a molecular weight of 356.87 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]-5-fluorospiro[1,2-dihydroindole-3,4'-piperidine] is sourced from PubChem (CID 58046534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).