C8H10N3+ — CID 58047087
3,6-dimethyl-3aH-triazolo[1,5-a]pyridin-8-ium (PubChem CID 58047087) has the molecular formula C8H10N3+ and a molecular weight of 148.19 g/mol. Its IUPAC name is 3,6-dimethyl-3aH-triazolo[1,5-a]pyridin-8-ium.
| Compound Name | 3,6-dimethyl-3aH-triazolo[1,5-a]pyridin-8-ium |
|---|---|
| PubChem CID | 58047087 |
| Molecular Formula | C8H10N3+ |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 3,6-dimethyl-3aH-triazolo[1,5-a]pyridin-8-ium |
| SMILES | CC1=C[N+]2=NN=C(C)C2C=C1 |
| InChI | InChI=1S/C8H10N3/c1-6-3-4-8-7(2)9-10-11(8)5-6/h3-5,8H,1-2H3/q+1 |
| InChIKey | MVQZIJYOTYTKLP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 27.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|