About 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine
2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 58047118) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
Analyze 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 58047118) is 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is Cc1ccc2c(n1)NC(C)C2.
What is the InChIKey of 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is VMXLBENROCBYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-6-3-4-8-5-7(2)11-9(8)10-6/h3-4,7H,5H2,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 58047118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).