About 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole
3,5-dimethyl-2,3-dihydro-1,2-benzothiazole (PubChem CID 58047185) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole |
| PubChem CID | 58047185 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole |
| SMILES | Cc1ccc2c(c1)C(C)NS2 |
| InChI | InChI=1S/C9H11NS/c1-6-3-4-9-8(5-6)7(2)10-11-9/h3-5,7,10H,1-2H3 |
| InChIKey | ZGWVQLFSIVVDNO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole?
The IUPAC name of 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole (CID 58047185) is 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole.
What is the SMILES notation for 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole?
The canonical SMILES for 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole is Cc1ccc2c(c1)C(C)NS2.
What is the InChIKey of 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole?
The InChIKey is ZGWVQLFSIVVDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-6-3-4-9-8(5-6)7(2)10-11-9/h3-5,7,10H,1-2H3.
What are the key properties of 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole?
3,5-dimethyl-2,3-dihydro-1,2-benzothiazole has a molecular weight of 165.26 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2,3-dihydro-1,2-benzothiazole is sourced from PubChem (CID 58047185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).