C17H25NORh — CID 58047260
6-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)ethyl]-5-methylpyridin-3-ol;rhodium (PubChem CID 58047260) has the molecular formula C17H25NORh and a molecular weight of 362.30 g/mol. Its IUPAC name is 6-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)ethyl]-5-methylpyridin-3-ol;rhodium.
| Compound Name | 6-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)ethyl]-5-methylpyridin-3-ol;rhodium |
|---|---|
| PubChem CID | 58047260 |
| Molecular Formula | C17H25NORh |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)ethyl]-5-methylpyridin-3-ol;rhodium |
| SMILES | Cc1cc(O)cnc1CCC1CCC2CCCC2C1.[Rh] |
| InChI | InChI=1S/C17H25NO.Rh/c1-12-9-16(19)11-18-17(12)8-6-13-5-7-14-3-2-4-15(14)10-13;/h9,11,13-15,19H,2-8,10H2,1H3; |
| InChIKey | WEQGTLKYDBHQJW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |