About 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine
3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine (PubChem CID 58047315) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine.
Analyze 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine?
The IUPAC name of 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine (CID 58047315) is 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine.
What is the SMILES notation for 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine?
The canonical SMILES for 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine is Cc1cnc2c(c1)C(C)NO2.
What is the InChIKey of 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine?
The InChIKey is ACOPJHSVSKXNLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-5-3-7-6(2)10-11-8(7)9-4-5/h3-4,6,10H,1-2H3.
What are the key properties of 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine?
3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine has a molecular weight of 150.18 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2,3-dihydro-[1,2]oxazolo[5,4-b]pyridine is sourced from PubChem (CID 58047315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).