About [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol
[4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol (PubChem CID 58047430) has the molecular formula C21H26O4
and a molecular weight of 342.44 g/mol. Its IUPAC name is [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol.
Molecular Properties
| Compound Name | [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol |
| PubChem CID | 58047430 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol |
| SMILES | COCOc1cc(CCc2ccc3c(c2)C(C)(C)CO3)ccc1CO |
| InChI | InChI=1S/C21H26O4/c1-21(2)13-24-19-9-7-15(10-18(19)21)4-5-16-6-8-17(12-22)20(11-16)25-14-23-3/h6-11,22H,4-5,12-14H2,1-3H3 |
| InChIKey | AWOWXBNDJYDELU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol?
The IUPAC name of [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol (CID 58047430) is [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol.
What is the SMILES notation for [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol?
The canonical SMILES for [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol is COCOc1cc(CCc2ccc3c(c2)C(C)(C)CO3)ccc1CO.
What is the InChIKey of [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol?
The InChIKey is AWOWXBNDJYDELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O4/c1-21(2)13-24-19-9-7-15(10-18(19)21)4-5-16-6-8-17(12-22)20(11-16)25-14-23-3/h6-11,22H,4-5,12-14H2,1-3H3.
What are the key properties of [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol?
[4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol has a molecular weight of 342.44 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethyl]-2-(methoxymethoxy)phenyl]methanol is sourced from PubChem (CID 58047430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).