C21H22FNO4 — CID 58047453
N-[1-[5-[(4-ethoxy-2-fluorophenyl)methoxy]-1-benzofuran-2-yl]ethyl]acetamide (PubChem CID 58047453) has the molecular formula C21H22FNO4 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[1-[5-[(4-ethoxy-2-fluorophenyl)methoxy]-1-benzofuran-2-yl]ethyl]acetamide.
| Compound Name | N-[1-[5-[(4-ethoxy-2-fluorophenyl)methoxy]-1-benzofuran-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 58047453 |
| Molecular Formula | C21H22FNO4 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[1-[5-[(4-ethoxy-2-fluorophenyl)methoxy]-1-benzofuran-2-yl]ethyl]acetamide |
| SMILES | CCOc1ccc(COc2ccc3oc(C(C)NC(C)=O)cc3c2)c(F)c1 |
| InChI | InChI=1S/C21H22FNO4/c1-4-25-18-6-5-15(19(22)11-18)12-26-17-7-8-20-16(9-17)10-21(27-20)13(2)23-14(3)24/h5-11,13H,4,12H2,1-3H3,(H,23,24) |
| InChIKey | RHQZTJXELUSXHM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |