About 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine
2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine (PubChem CID 58047670) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine |
| PubChem CID | 58047670 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine |
| SMILES | CC1=CC2C=C(C)NN2C=C1 |
| InChI | InChI=1S/C9H12N2/c1-7-3-4-11-9(5-7)6-8(2)10-11/h3-6,9-10H,1-2H3 |
| InChIKey | DLYCTPCWEGTPGG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine?
The IUPAC name of 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine (CID 58047670) is 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine.
What is the SMILES notation for 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine?
The canonical SMILES for 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine is CC1=CC2C=C(C)NN2C=C1.
What is the InChIKey of 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine?
The InChIKey is DLYCTPCWEGTPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-7-3-4-11-9(5-7)6-8(2)10-11/h3-6,9-10H,1-2H3.
What are the key properties of 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine?
2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine is sourced from PubChem (CID 58047670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).