C24H18ClF5N12O2 — CID 58047935
1-(3-chloro-2-pyridinyl)-N-[2-methyl-6-(methylcarbamoyl)-4-(1,2,4-triazol-1-yl)phenyl]-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carboxamide (PubChem CID 58047935) has the molecular formula C24H18ClF5N12O2 and a molecular weight of 636.93 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-[2-methyl-6-(methylcarbamoyl)-4-(1,2,4-triazol-1-yl)phenyl]-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carboxamide.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-[2-methyl-6-(methylcarbamoyl)-4-(1,2,4-triazol-1-yl)phenyl]-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58047935 |
| Molecular Formula | C24H18ClF5N12O2 |
| Molecular Weight | 636.93 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-[2-methyl-6-(methylcarbamoyl)-4-(1,2,4-triazol-1-yl)phenyl]-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1cc(-n2cncn2)cc(C)c1NC(=O)c1cc(Cn2nnc(C(F)(F)C(F)(F)F)n2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C24H18ClF5N12O2/c1-12-6-14(40-11-32-10-34-40)8-15(20(43)31-2)18(12)35-21(44)17-7-13(37-42(17)19-16(25)4-3-5-33-19)9-41-38-22(36-39-41)23(26,27)24(28,29)30/h3-8,10-11H,9H2,1-2H3,(H,31,43)(H,35,44) |
| InChIKey | REJZNWZCBMEXNG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|