C30H29ClF5N9O4 — CID 58047949
cyclopropylmethyl 3-(tert-butylcarbamoyl)-4-[[1-(3-chloro-2-pyridinyl)-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carbonyl]amino]-5-methylbenzoate (PubChem CID 58047949) has the molecular formula C30H29ClF5N9O4 and a molecular weight of 710.06 g/mol. Its IUPAC name is cyclopropylmethyl 3-(tert-butylcarbamoyl)-4-[[1-(3-chloro-2-pyridinyl)-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carbonyl]amino]-5-methylbenzoate.
| Compound Name | cyclopropylmethyl 3-(tert-butylcarbamoyl)-4-[[1-(3-chloro-2-pyridinyl)-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carbonyl]amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 58047949 |
| Molecular Formula | C30H29ClF5N9O4 |
| Molecular Weight | 710.06 g/mol |
| Exact Mass | 709.20 |
| IUPAC Name | cyclopropylmethyl 3-(tert-butylcarbamoyl)-4-[[1-(3-chloro-2-pyridinyl)-3-[[5-(1,1,2,2,2-pentafluoroethyl)tetrazol-2-yl]methyl]pyrazole-5-carbonyl]amino]-5-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCC2CC2)cc(C(=O)NC(C)(C)C)c1NC(=O)c1cc(Cn2nnc(C(F)(F)C(F)(F)F)n2)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C30H29ClF5N9O4/c1-15-10-17(26(48)49-14-16-7-8-16)11-19(24(46)39-28(2,3)4)22(15)38-25(47)21-12-18(41-45(21)23-20(31)6-5-9-37-23)13-44-42-27(40-43-44)29(32,33)30(34,35)36/h5-6,9-12,16H,7-8,13-14H2,1-4H3,(H,38,47)(H,39,46) |
| InChIKey | SONTTYMXINSYOY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|