C12H20O3 — CID 58047972
(3aS,4S,7aR)-2,2-diethyl-6-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 58047972) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3aS,4S,7aR)-2,2-diethyl-6-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4S,7aR)-2,2-diethyl-6-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 58047972 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3aS,4S,7aR)-2,2-diethyl-6-methyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CCC1(CC)O[C@H]2[C@@H](O)C=C(C)C[C@H]2O1 |
| InChI | InChI=1S/C12H20O3/c1-4-12(5-2)14-10-7-8(3)6-9(13)11(10)15-12/h6,9-11,13H,4-5,7H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | GKKNBCZFYGYUOX-AXFHLTTASA-N |
| XLogP | 2.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|